C10H2F12O3 — CID 15416944
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-4a,8-dihydroxynaphthalen-1-one (PubChem CID 15416944) has the molecular formula C10H2F12O3 and a molecular weight of 398.10 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-4a,8-dihydroxynaphthalen-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-4a,8-dihydroxynaphthalen-1-one |
|---|---|
| PubChem CID | 15416944 |
| Molecular Formula | C10H2F12O3 |
| Molecular Weight | 398.10 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-4a,8-dihydroxynaphthalen-1-one |
| SMILES | O=C1C2=C(O)C(F)(F)C(F)(F)C(F)(F)C2(O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H2F12O3/c11-5(12)2(23)1-3(24)6(13,14)10(21,22)8(17,18)4(1,25)7(15,16)9(5,19)20/h23,25H |
| InChIKey | YMBIMJNZCQQVND-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|