C7H8F6O — CID 164528784
ethane;2,2,3,3,4,4-hexafluorocyclopentan-1-one (PubChem CID 164528784) has the molecular formula C7H8F6O and a molecular weight of 222.13 g/mol. Its IUPAC name is ethane;2,2,3,3,4,4-hexafluorocyclopentan-1-one.
| Compound Name | ethane;2,2,3,3,4,4-hexafluorocyclopentan-1-one |
|---|---|
| PubChem CID | 164528784 |
| Molecular Formula | C7H8F6O |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | ethane;2,2,3,3,4,4-hexafluorocyclopentan-1-one |
| SMILES | CC.O=C1CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H2F6O.C2H6/c6-3(7)1-2(12)4(8,9)5(3,10)11;1-2/h1H2;1-2H3 |
| InChIKey | MADBUKYGEVSFCQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|