C18H13F8P — CID 174272811
diphenylphosphane;1,2,3,3,4,4,5,5-octafluorocyclohexene (PubChem CID 174272811) has the molecular formula C18H13F8P and a molecular weight of 412.26 g/mol. Its IUPAC name is diphenylphosphane;1,2,3,3,4,4,5,5-octafluorocyclohexene.
| Compound Name | diphenylphosphane;1,2,3,3,4,4,5,5-octafluorocyclohexene |
|---|---|
| PubChem CID | 174272811 |
| Molecular Formula | C18H13F8P |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | diphenylphosphane;1,2,3,3,4,4,5,5-octafluorocyclohexene |
| SMILES | FC1=C(F)C(F)(F)C(F)(F)C(F)(F)C1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C6H2F8/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-2-1-4(9,10)6(13,14)5(11,12)3(2)8/h1-10,13H;1H2 |
| InChIKey | JTGYHTAOXQENHN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|