C8H2F8O — CID 87325926
2,3,4,5,6-pentafluoro-1-(1,2,2-trifluoroethenyl)cyclohexa-2,4-dien-1-ol (PubChem CID 87325926) has the molecular formula C8H2F8O and a molecular weight of 266.09 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-1-(1,2,2-trifluoroethenyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 2,3,4,5,6-pentafluoro-1-(1,2,2-trifluoroethenyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 87325926 |
| Molecular Formula | C8H2F8O |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-1-(1,2,2-trifluoroethenyl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1(C(F)=C(F)F)C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C8H2F8O/c9-1-2(10)4(12)8(17,5(13)3(1)11)6(14)7(15)16/h4,17H |
| InChIKey | QFOOPBULVLYNBV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |