C12H4F10O2S — CID 175402832
2,3,4,5,6-pentafluoro-4-(1,2,3,5,6-pentafluoro-4-hydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-dien-1-ol (PubChem CID 175402832) has the molecular formula C12H4F10O2S and a molecular weight of 402.21 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-4-(1,2,3,5,6-pentafluoro-4-hydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-dien-1-ol.
| Compound Name | 2,3,4,5,6-pentafluoro-4-(1,2,3,5,6-pentafluoro-4-hydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 175402832 |
| Molecular Formula | C12H4F10O2S |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-4-(1,2,3,5,6-pentafluoro-4-hydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-dien-1-ol |
| SMILES | OC1=C(F)C(F)C(F)(SC2(F)C(F)=C(F)C(O)=C(F)C2F)C(F)=C1F |
| InChI | InChI=1S/C12H4F10O2S/c13-1-5(23)2(14)8(18)11(21,7(1)17)25-12(22)9(19)3(15)6(24)4(16)10(12)20/h7,9,23-24H |
| InChIKey | ATYUZQVWPKICRI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |