C11H10F4O5S — CID 163919653
2,3,5,6-tetrafluoro-4-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 163919653) has the molecular formula C11H10F4O5S and a molecular weight of 330.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 163919653 |
| Molecular Formula | C11H10F4O5S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC1(C)C(F)=C(F)C(S(=O)(=O)O)=C(F)C1F |
| InChI | InChI=1S/C11H10F4O5S/c1-4(2)10(16)20-11(3)8(14)5(12)7(21(17,18)19)6(13)9(11)15/h8H,1H2,2-3H3,(H,17,18,19) |
| InChIKey | QZHUVVDVHMZRRQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|