C13H18O10S2 — CID 90822933
1,2-bis(2-methylprop-2-enoyloxy)-4-(sulfomethyl)cyclobutane-1-sulfonic acid (PubChem CID 90822933) has the molecular formula C13H18O10S2 and a molecular weight of 398.41 g/mol. Its IUPAC name is 1,2-bis(2-methylprop-2-enoyloxy)-4-(sulfomethyl)cyclobutane-1-sulfonic acid.
| Compound Name | 1,2-bis(2-methylprop-2-enoyloxy)-4-(sulfomethyl)cyclobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 90822933 |
| Molecular Formula | C13H18O10S2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1,2-bis(2-methylprop-2-enoyloxy)-4-(sulfomethyl)cyclobutane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC1CC(CS(=O)(=O)O)C1(OC(=O)C(=C)C)S(=O)(=O)O |
| InChI | InChI=1S/C13H18O10S2/c1-7(2)11(14)22-10-5-9(6-24(16,17)18)13(10,25(19,20)21)23-12(15)8(3)4/h9-10H,1,3,5-6H2,2,4H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | HMGBITORSRLRTL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|