C12H15NO3 — CID 142751751
(1-isocyanato-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate (PubChem CID 142751751) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (1-isocyanato-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate.
| Compound Name | (1-isocyanato-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142751751 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (1-isocyanato-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CCC1(N=C=O)C2 |
| InChI | InChI=1S/C12H15NO3/c1-8(2)11(15)16-10-5-9-3-4-12(10,6-9)13-7-14/h9-10H,1,3-6H2,2H3 |
| InChIKey | LUERPEMOSHDVBH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|