C6H3F7 — CID 87084406
1,2,3,3,4,5,6-heptafluorocyclohexene (PubChem CID 87084406) has the molecular formula C6H3F7 and a molecular weight of 208.08 g/mol. Its IUPAC name is 1,2,3,3,4,5,6-heptafluorocyclohexene.
| Compound Name | 1,2,3,3,4,5,6-heptafluorocyclohexene |
|---|---|
| PubChem CID | 87084406 |
| Molecular Formula | C6H3F7 |
| Molecular Weight | 208.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 1,2,3,3,4,5,6-heptafluorocyclohexene |
| SMILES | FC1=C(F)C(F)(F)C(F)C(F)C1F |
| InChI | InChI=1S/C6H3F7/c7-1-2(8)4(10)6(12,13)5(11)3(1)9/h1-2,4H |
| InChIKey | GDJBXQOBLNXIGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.08 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |