C7H7F5O — CID 88890812
[(1R)-2,3,4,5,6-pentafluorocyclohex-3-en-1-yl]methanol (PubChem CID 88890812) has the molecular formula C7H7F5O and a molecular weight of 202.12 g/mol. Its IUPAC name is [(1R)-2,3,4,5,6-pentafluorocyclohex-3-en-1-yl]methanol.
| Compound Name | [(1R)-2,3,4,5,6-pentafluorocyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 88890812 |
| Molecular Formula | C7H7F5O |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | [(1R)-2,3,4,5,6-pentafluorocyclohex-3-en-1-yl]methanol |
| SMILES | OC[C@H]1C(F)C(F)=C(F)C(F)C1F |
| InChI | InChI=1S/C7H7F5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h2-5,13H,1H2/t2-,3?,4?,5?/m1/s1 |
| InChIKey | HDEVMVJRTCWNCY-UOJHMQKMSA-N |
| XLogP | 1.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |