C11H20O8 — CID 100995414
(1R,2S,3R,4S,4aR,5S,6R,7R,8S,8aR)-8-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,3,4,5,6,7-heptol (PubChem CID 100995414) has the molecular formula C11H20O8 and a molecular weight of 280.27 g/mol. Its IUPAC name is (1R,2S,3R,4S,4aR,5S,6R,7R,8S,8aR)-8-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,3,4,5,6,7-heptol.
| Compound Name | (1R,2S,3R,4S,4aR,5S,6R,7R,8S,8aR)-8-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,3,4,5,6,7-heptol |
|---|---|
| PubChem CID | 100995414 |
| Molecular Formula | C11H20O8 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (1R,2S,3R,4S,4aR,5S,6R,7R,8S,8aR)-8-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,3,4,5,6,7-heptol |
| SMILES | OC[C@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@@H]2[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]12 |
| InChI | InChI=1S/C11H20O8/c12-1-2-3-4(7(15)9(17)5(2)13)8(16)11(19)10(18)6(3)14/h2-19H,1H2/t2-,3-,4-,5-,6-,7+,8+,9-,10+,11-/m1/s1 |
| InChIKey | OLRLSWATFBMDPK-SUODNQJNSA-N |
| XLogP | -4.62 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |