C7H15O8P — CID 71598162
[(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]methylphosphonic acid (PubChem CID 71598162) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]methylphosphonic acid.
| Compound Name | [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]methylphosphonic acid |
|---|---|
| PubChem CID | 71598162 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]methylphosphonic acid |
| SMILES | O=P(O)(O)CC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15O8P/c8-3-2(1-16(13,14)15)4(9)6(11)7(12)5(3)10/h2-12H,1H2,(H2,13,14,15)/t2?,3-,4-,5-,6+,7?/m0/s1 |
| InChIKey | SPMGFBFPGVDAAD-FEPQRWDDSA-N |
| XLogP | -3.40 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|