C8H18O10P2 — CID 122129552
[(2R,3S,5S,6S)-2,3,5,6-tetrahydroxy-4-(phosphonomethyl)cyclohexyl]methylphosphonic acid (PubChem CID 122129552) has the molecular formula C8H18O10P2 and a molecular weight of 336.17 g/mol. Its IUPAC name is [(2R,3S,5S,6S)-2,3,5,6-tetrahydroxy-4-(phosphonomethyl)cyclohexyl]methylphosphonic acid.
| Compound Name | [(2R,3S,5S,6S)-2,3,5,6-tetrahydroxy-4-(phosphonomethyl)cyclohexyl]methylphosphonic acid |
|---|---|
| PubChem CID | 122129552 |
| Molecular Formula | C8H18O10P2 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [(2R,3S,5S,6S)-2,3,5,6-tetrahydroxy-4-(phosphonomethyl)cyclohexyl]methylphosphonic acid |
| SMILES | O=P(O)(O)CC1[C@@H](O)[C@@H](O)C(CP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H18O10P2/c9-5-3(1-19(13,14)15)6(10)8(12)4(7(5)11)2-20(16,17)18/h3-12H,1-2H2,(H2,13,14,15)(H2,16,17,18)/t3?,4?,5-,6-,7-,8+/m0/s1 |
| InChIKey | SCDZBVCBCDLYHO-LIMHGSMISA-N |
| XLogP | -2.97 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|