C7H15O8P — CID 46926290
[(2S,3S,4R,6S)-6-(dihydroxymethyl)-3,4-dihydroxyoxan-2-yl]methylphosphonic acid (PubChem CID 46926290) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is [(2S,3S,4R,6S)-6-(dihydroxymethyl)-3,4-dihydroxyoxan-2-yl]methylphosphonic acid.
| Compound Name | [(2S,3S,4R,6S)-6-(dihydroxymethyl)-3,4-dihydroxyoxan-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 46926290 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [(2S,3S,4R,6S)-6-(dihydroxymethyl)-3,4-dihydroxyoxan-2-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)C[C@H]1O[C@H](C(O)O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H15O8P/c8-3-1-4(7(10)11)15-5(6(3)9)2-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4+,5-,6+/m1/s1 |
| InChIKey | RFDYJBWISAWOLP-MOJAZDJTSA-N |
| XLogP | -2.65 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|