C9H18O4 — CID 20758150
6-(2-methylpropyl)oxane-2,4,5-triol (PubChem CID 20758150) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 6-(2-methylpropyl)oxane-2,4,5-triol.
| Compound Name | 6-(2-methylpropyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 20758150 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 6-(2-methylpropyl)oxane-2,4,5-triol |
| SMILES | CC(C)CC1OC(O)CC(O)C1O |
| InChI | InChI=1S/C9H18O4/c1-5(2)3-7-9(12)6(10)4-8(11)13-7/h5-12H,3-4H2,1-2H3 |
| InChIKey | NKWGKCVTDSTUQT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |