About oxane-2,3,4,6-tetrol
oxane-2,3,4,6-tetrol (PubChem CID 123881821) has the molecular formula C5H10O5
and a molecular weight of 150.13 g/mol. Its IUPAC name is oxane-2,3,4,6-tetrol.
Molecular Properties
| Compound Name | oxane-2,3,4,6-tetrol |
| PubChem CID | 123881821 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | oxane-2,3,4,6-tetrol |
| SMILES | OC1CC(O)C(O)C(O)O1 |
| InChI | InChI=1S/C5H10O5/c6-2-1-3(7)10-5(9)4(2)8/h2-9H,1H2 |
| InChIKey | DZQYWSXFALHNIQ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxane-2,3,4,6-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,3,4,6-tetrol?
The IUPAC name of oxane-2,3,4,6-tetrol (CID 123881821) is oxane-2,3,4,6-tetrol.
What is the SMILES notation for oxane-2,3,4,6-tetrol?
The canonical SMILES for oxane-2,3,4,6-tetrol is OC1CC(O)C(O)C(O)O1.
What is the InChIKey of oxane-2,3,4,6-tetrol?
The InChIKey is DZQYWSXFALHNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5/c6-2-1-3(7)10-5(9)4(2)8/h2-9H,1H2.
What are the key properties of oxane-2,3,4,6-tetrol?
oxane-2,3,4,6-tetrol has a molecular weight of 150.13 g/mol, XLogP of -2.23, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,3,4,6-tetrol is sourced from PubChem (CID 123881821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).