C5H10O5 — CID 123881821
oxane-2,3,4,6-tetrol (PubChem CID 123881821) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is oxane-2,3,4,6-tetrol.
| Compound Name | oxane-2,3,4,6-tetrol |
|---|---|
| PubChem CID | 123881821 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | oxane-2,3,4,6-tetrol |
| SMILES | OC1CC(O)C(O)C(O)O1 |
| InChI | InChI=1S/C5H10O5/c6-2-1-3(7)10-5(9)4(2)8/h2-9H,1H2 |
| InChIKey | DZQYWSXFALHNIQ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |