C6H11F2O6P — CID 173216740
[2-[(2R,3S,4S)-3,4-dihydroxyoxolan-2-yl]-1,1-difluoroethyl]phosphonic acid (PubChem CID 173216740) has the molecular formula C6H11F2O6P and a molecular weight of 248.12 g/mol. Its IUPAC name is [2-[(2R,3S,4S)-3,4-dihydroxyoxolan-2-yl]-1,1-difluoroethyl]phosphonic acid.
| Compound Name | [2-[(2R,3S,4S)-3,4-dihydroxyoxolan-2-yl]-1,1-difluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 173216740 |
| Molecular Formula | C6H11F2O6P |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | [2-[(2R,3S,4S)-3,4-dihydroxyoxolan-2-yl]-1,1-difluoroethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)C[C@H]1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11F2O6P/c7-6(8,15(11,12)13)1-4-5(10)3(9)2-14-4/h3-5,9-10H,1-2H2,(H2,11,12,13)/t3-,4+,5-/m0/s1 |
| InChIKey | TXCVURGIHLDXLW-LMVFSUKVSA-N |
| XLogP | -0.73 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|