C6H11NO6 — CID 11745494
(2R,3R,4R,5R)-2-(nitromethyl)oxane-3,4,5-triol (PubChem CID 11745494) has the molecular formula C6H11NO6 and a molecular weight of 193.15 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(nitromethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R)-2-(nitromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11745494 |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.15 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (2R,3R,4R,5R)-2-(nitromethyl)oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])C[C@H]1OC[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11NO6/c8-3-2-13-4(1-7(11)12)6(10)5(3)9/h3-6,8-10H,1-2H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | KYBWIVQIHUYTAA-KAZBKCHUSA-N |
| XLogP | -2.26 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.15 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|