C8H16O6 — CID 25167508
(1S,2R,3R,4S,5R,6S)-5,6-bis(hydroxymethyl)cyclohexane-1,2,3,4-tetrol (PubChem CID 25167508) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R,6S)-5,6-bis(hydroxymethyl)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R,4S,5R,6S)-5,6-bis(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 25167508 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (1S,2R,3R,4S,5R,6S)-5,6-bis(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
| SMILES | OC[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1CO |
| InChI | InChI=1S/C8H16O6/c9-1-3-4(2-10)6(12)8(14)7(13)5(3)11/h3-14H,1-2H2/t3-,4+,5-,6-,7+,8+/m0/s1 |
| InChIKey | BOKWBQOFOOHFLP-NOVZGDRXSA-N |
| XLogP | -3.34 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |