C7H12O4S — CID 10261988
(1R,2R,3S,4R,5R,6S)-5-(hydroxymethyl)-7-thiabicyclo[4.1.0]heptane-2,3,4-triol (PubChem CID 10261988) has the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R,6S)-5-(hydroxymethyl)-7-thiabicyclo[4.1.0]heptane-2,3,4-triol.
| Compound Name | (1R,2R,3S,4R,5R,6S)-5-(hydroxymethyl)-7-thiabicyclo[4.1.0]heptane-2,3,4-triol |
|---|---|
| PubChem CID | 10261988 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (1R,2R,3S,4R,5R,6S)-5-(hydroxymethyl)-7-thiabicyclo[4.1.0]heptane-2,3,4-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H]2S[C@@H]12 |
| InChI | InChI=1S/C7H12O4S/c8-1-2-3(9)4(10)5(11)7-6(2)12-7/h2-11H,1H2/t2-,3-,4+,5-,6+,7-/m1/s1 |
| InChIKey | AQDGPWMNOLOSQX-XQCVOTFFSA-N |
| XLogP | -1.82 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|