C7H12O8S — CID 129316474
(3aR,4R,5S,6R,7R,7aS)-7-(hydroxymethyl)-2,2-dioxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole-4,5,6-triol (PubChem CID 129316474) has the molecular formula C7H12O8S and a molecular weight of 256.23 g/mol. Its IUPAC name is (3aR,4R,5S,6R,7R,7aS)-7-(hydroxymethyl)-2,2-dioxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole-4,5,6-triol.
| Compound Name | (3aR,4R,5S,6R,7R,7aS)-7-(hydroxymethyl)-2,2-dioxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole-4,5,6-triol |
|---|---|
| PubChem CID | 129316474 |
| Molecular Formula | C7H12O8S |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (3aR,4R,5S,6R,7R,7aS)-7-(hydroxymethyl)-2,2-dioxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole-4,5,6-triol |
| SMILES | O=S1(=O)O[C@@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)[C@@H]2O1 |
| InChI | InChI=1S/C7H12O8S/c8-1-2-3(9)4(10)5(11)7-6(2)14-16(12,13)15-7/h2-11H,1H2/t2-,3-,4+,5-,6+,7-/m1/s1 |
| InChIKey | ZCXRKCCKXOHKLN-XQCVOTFFSA-N |
| XLogP | -3.28 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |