C12H16O2 — CID 98503945
[(1S,2R,5R,6S,7S,8R)-8-(hydroxymethyl)-7-tricyclo[4.2.2.02,5]deca-3,9-dienyl]methanol (PubChem CID 98503945) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is [(1S,2R,5R,6S,7S,8R)-8-(hydroxymethyl)-7-tricyclo[4.2.2.02,5]deca-3,9-dienyl]methanol.
| Compound Name | [(1S,2R,5R,6S,7S,8R)-8-(hydroxymethyl)-7-tricyclo[4.2.2.02,5]deca-3,9-dienyl]methanol |
|---|---|
| PubChem CID | 98503945 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | [(1S,2R,5R,6S,7S,8R)-8-(hydroxymethyl)-7-tricyclo[4.2.2.02,5]deca-3,9-dienyl]methanol |
| SMILES | OC[C@@H]1[C@H]2C=C[C@@H]([C@@H]3C=C[C@H]32)[C@@H]1CO |
| InChI | InChI=1S/C12H16O2/c13-5-11-9-3-4-10(12(11)6-14)8-2-1-7(8)9/h1-4,7-14H,5-6H2/t7-,8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | BBCVWBYIGLSLER-IXJGYNTHSA-N |
| XLogP | 0.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|