C14H14O4-2 — CID 22214674
2-[10-(carboxylatomethyl)-9-tricyclo[4.2.1.12,5]deca-3,7-dienyl]acetate (PubChem CID 22214674) has the molecular formula C14H14O4-2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[10-(carboxylatomethyl)-9-tricyclo[4.2.1.12,5]deca-3,7-dienyl]acetate.
| Compound Name | 2-[10-(carboxylatomethyl)-9-tricyclo[4.2.1.12,5]deca-3,7-dienyl]acetate |
|---|---|
| PubChem CID | 22214674 |
| Molecular Formula | C14H14O4-2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[10-(carboxylatomethyl)-9-tricyclo[4.2.1.12,5]deca-3,7-dienyl]acetate |
| SMILES | O=C([O-])CC1C2C=CC1C1C=CC2C1CC(=O)[O-] |
| InChI | InChI=1S/C14H16O4/c15-13(16)5-11-7-1-2-8(11)10-4-3-9(7)12(10)6-14(17)18/h1-4,7-12H,5-6H2,(H,15,16)(H,17,18)/p-2 |
| InChIKey | LKGZZIXGFWFLEN-UHFFFAOYSA-L |
| XLogP | -0.88 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|