C5H2F6 — CID 23235244
(4R)-1,3,3,4,5,5-hexafluorocyclopentene (PubChem CID 23235244) has the molecular formula C5H2F6 and a molecular weight of 176.06 g/mol. Its IUPAC name is (4R)-1,3,3,4,5,5-hexafluorocyclopentene.
| Compound Name | (4R)-1,3,3,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 23235244 |
| Molecular Formula | C5H2F6 |
| Molecular Weight | 176.06 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | (4R)-1,3,3,4,5,5-hexafluorocyclopentene |
| SMILES | FC1=CC(F)(F)[C@@H](F)C1(F)F |
| InChI | InChI=1S/C5H2F6/c6-2-1-4(8,9)3(7)5(2,10)11/h1,3H/t3-/m1/s1 |
| InChIKey | GZPSNAONUGNAKA-GSVOUGTGSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.06 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |