About 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene
1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene (PubChem CID 141400646) has the molecular formula C7H6F4O
and a molecular weight of 182.12 g/mol. Its IUPAC name is 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene.
Analyze 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene?
The IUPAC name of 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene (CID 141400646) is 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene.
What is the SMILES notation for 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene?
The canonical SMILES for 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene is COC1(F)C(F)=CC=C(F)C1F.
What is the InChIKey of 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene?
The InChIKey is FCXWIWLOJQLGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F4O/c1-12-7(11)5(9)3-2-4(8)6(7)10/h2-3,6H,1H3.
What are the key properties of 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene?
1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene has a molecular weight of 182.12 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5,6-tetrafluoro-5-methoxycyclohexa-1,3-diene is sourced from PubChem (CID 141400646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).