C6H4F4O2 — CID 89420440
2,3,4,5-tetrafluorocyclohexa-1,5-diene-1,4-diol (PubChem CID 89420440) has the molecular formula C6H4F4O2 and a molecular weight of 184.09 g/mol. Its IUPAC name is 2,3,4,5-tetrafluorocyclohexa-1,5-diene-1,4-diol.
| Compound Name | 2,3,4,5-tetrafluorocyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 89420440 |
| Molecular Formula | C6H4F4O2 |
| Molecular Weight | 184.09 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 2,3,4,5-tetrafluorocyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=C(F)C(F)C(O)(F)C(F)=C1 |
| InChI | InChI=1S/C6H4F4O2/c7-3-1-2(11)4(8)5(9)6(3,10)12/h1,5,11-12H |
| InChIKey | MNATVIDWTWSCKT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.09 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |