C11H17BF2O3 — CID 139733817
(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid (PubChem CID 139733817) has the molecular formula C11H17BF2O3 and a molecular weight of 246.06 g/mol. Its IUPAC name is (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid.
| Compound Name | (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid |
|---|---|
| PubChem CID | 139733817 |
| Molecular Formula | C11H17BF2O3 |
| Molecular Weight | 246.06 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid |
| SMILES | CCCCCC1(OB(O)O)C=CC=C(F)C1F |
| InChI | InChI=1S/C11H17BF2O3/c1-2-3-4-7-11(17-12(15)16)8-5-6-9(13)10(11)14/h5-6,8,10,15-16H,2-4,7H2,1H3 |
| InChIKey | OAZSULCWBVLPQO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.06 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|