(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid

C11H17BF2O3 — CID 139733817

IUPAC(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid
SMILESCCCCCC1(OB(O)O)C=CC=C(F)C1F
InChIInChI=1S/C11H17BF2O3/c1-2-3-4-7-11(17-12(15)16)8-5-6-9(13)10(11)14/h5-6,8,10,15-16H,2-4,7H2,1H3
InChIKeyOAZSULCWBVLPQO-UHFFFAOYSA-N
MW246.06 g/mol
LogP2.05
Rot. Bonds6

About (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid

(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid (PubChem CID 139733817) has the molecular formula C11H17BF2O3 and a molecular weight of 246.06 g/mol. Its IUPAC name is (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid.

Molecular Properties

Compound Name(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid
PubChem CID139733817
Molecular FormulaC11H17BF2O3
Molecular Weight246.06 g/mol
Exact Mass246.12
IUPAC Name(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid
SMILESCCCCCC1(OB(O)O)C=CC=C(F)C1F
InChIInChI=1S/C11H17BF2O3/c1-2-3-4-7-11(17-12(15)16)8-5-6-9(13)10(11)14/h5-6,8,10,15-16H,2-4,7H2,1H3
InChIKeyOAZSULCWBVLPQO-UHFFFAOYSA-N
XLogP2.05
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.06
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid?
The IUPAC name of (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid (CID 139733817) is (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid.
What is the SMILES notation for (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid?
The canonical SMILES for (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid is CCCCCC1(OB(O)O)C=CC=C(F)C1F.
What is the InChIKey of (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid?
The InChIKey is OAZSULCWBVLPQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BF2O3/c1-2-3-4-7-11(17-12(15)16)8-5-6-9(13)10(11)14/h5-6,8,10,15-16H,2-4,7H2,1H3.
What are the key properties of (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid?
(5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid has a molecular weight of 246.06 g/mol, XLogP of 2.05, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-difluoro-1-pentylcyclohexa-2,4-dien-1-yl)oxyboronic acid is sourced from PubChem (CID 139733817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).