2,6-dipentyl-1H-pyridine-2-carboxylic acid

C16H27NO2 — CID 70482492

IUPAC2,6-dipentyl-1H-pyridine-2-carboxylic acid
SMILESCCCCCC1=CC=CC(CCCCC)(C(=O)O)N1
InChIInChI=1S/C16H27NO2/c1-3-5-7-10-14-11-9-13-16(17-14,15(18)19)12-8-6-4-2/h9,11,13,17H,3-8,10,12H2,1-2H3,(H,18,19)
InChIKeyVPHIFSLJBHTRRE-UHFFFAOYSA-N
MW265.40 g/mol
LogP4.01
Rot. Bonds9

About 2,6-dipentyl-1H-pyridine-2-carboxylic acid

2,6-dipentyl-1H-pyridine-2-carboxylic acid (PubChem CID 70482492) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2,6-dipentyl-1H-pyridine-2-carboxylic acid.

Molecular Properties

Compound Name2,6-dipentyl-1H-pyridine-2-carboxylic acid
PubChem CID70482492
Molecular FormulaC16H27NO2
Molecular Weight265.40 g/mol
Exact Mass265.20
IUPAC Name2,6-dipentyl-1H-pyridine-2-carboxylic acid
SMILESCCCCCC1=CC=CC(CCCCC)(C(=O)O)N1
InChIInChI=1S/C16H27NO2/c1-3-5-7-10-14-11-9-13-16(17-14,15(18)19)12-8-6-4-2/h9,11,13,17H,3-8,10,12H2,1-2H3,(H,18,19)
InChIKeyVPHIFSLJBHTRRE-UHFFFAOYSA-N
XLogP4.01
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.40
LogP ≤ 54.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,6-dipentyl-1H-pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dipentyl-1H-pyridine-2-carboxylic acid?
The IUPAC name of 2,6-dipentyl-1H-pyridine-2-carboxylic acid (CID 70482492) is 2,6-dipentyl-1H-pyridine-2-carboxylic acid.
What is the SMILES notation for 2,6-dipentyl-1H-pyridine-2-carboxylic acid?
The canonical SMILES for 2,6-dipentyl-1H-pyridine-2-carboxylic acid is CCCCCC1=CC=CC(CCCCC)(C(=O)O)N1.
What is the InChIKey of 2,6-dipentyl-1H-pyridine-2-carboxylic acid?
The InChIKey is VPHIFSLJBHTRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2/c1-3-5-7-10-14-11-9-13-16(17-14,15(18)19)12-8-6-4-2/h9,11,13,17H,3-8,10,12H2,1-2H3,(H,18,19).
What are the key properties of 2,6-dipentyl-1H-pyridine-2-carboxylic acid?
2,6-dipentyl-1H-pyridine-2-carboxylic acid has a molecular weight of 265.40 g/mol, XLogP of 4.01, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dipentyl-1H-pyridine-2-carboxylic acid is sourced from PubChem (CID 70482492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).