C16H27NO2 — CID 70482492
2,6-dipentyl-1H-pyridine-2-carboxylic acid (PubChem CID 70482492) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2,6-dipentyl-1H-pyridine-2-carboxylic acid.
| Compound Name | 2,6-dipentyl-1H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 70482492 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2,6-dipentyl-1H-pyridine-2-carboxylic acid |
| SMILES | CCCCCC1=CC=CC(CCCCC)(C(=O)O)N1 |
| InChI | InChI=1S/C16H27NO2/c1-3-5-7-10-14-11-9-13-16(17-14,15(18)19)12-8-6-4-2/h9,11,13,17H,3-8,10,12H2,1-2H3,(H,18,19) |
| InChIKey | VPHIFSLJBHTRRE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|