C33H56O6 — CID 90093268
1,2,5-trioctylcyclohexa-3,5-diene-1,2,4-tricarboxylic acid (PubChem CID 90093268) has the molecular formula C33H56O6 and a molecular weight of 548.81 g/mol. Its IUPAC name is 1,2,5-trioctylcyclohexa-3,5-diene-1,2,4-tricarboxylic acid.
| Compound Name | 1,2,5-trioctylcyclohexa-3,5-diene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 90093268 |
| Molecular Formula | C33H56O6 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | 1,2,5-trioctylcyclohexa-3,5-diene-1,2,4-tricarboxylic acid |
| SMILES | CCCCCCCCC1=CC(CCCCCCCC)(C(=O)O)C(CCCCCCCC)(C(=O)O)C=C1C(=O)O |
| InChI | InChI=1S/C33H56O6/c1-4-7-10-13-16-19-22-27-25-32(30(36)37,23-20-17-14-11-8-5-2)33(31(38)39,26-28(27)29(34)35)24-21-18-15-12-9-6-3/h25-26H,4-24H2,1-3H3,(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | IPSBYBYHHVEXQM-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|