C20H32O4 — CID 151803066
2-tert-butyl-5-heptyl-5-methylcyclohexa-1,3-diene-1,3-dicarboxylic acid (PubChem CID 151803066) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2-tert-butyl-5-heptyl-5-methylcyclohexa-1,3-diene-1,3-dicarboxylic acid.
| Compound Name | 2-tert-butyl-5-heptyl-5-methylcyclohexa-1,3-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151803066 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-tert-butyl-5-heptyl-5-methylcyclohexa-1,3-diene-1,3-dicarboxylic acid |
| SMILES | CCCCCCCC1(C)C=C(C(=O)O)C(C(C)(C)C)=C(C(=O)O)C1 |
| InChI | InChI=1S/C20H32O4/c1-6-7-8-9-10-11-20(5)12-14(17(21)22)16(19(2,3)4)15(13-20)18(23)24/h12H,6-11,13H2,1-5H3,(H,21,22)(H,23,24) |
| InChIKey | RZAJKKVRTGEGLA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|