1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid

C15H22O4 — CID 150777608

IUPAC1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILESCCCCCCC1(C(=O)O)C=CC(C)=C(C(=O)O)C1
InChIInChI=1S/C15H22O4/c1-3-4-5-6-8-15(14(18)19)9-7-11(2)12(10-15)13(16)17/h7,9H,3-6,8,10H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyKBEMDJCHEYTPAD-UHFFFAOYSA-N
MW266.34 g/mol
LogP3.39
Rot. Bonds7

About 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid

1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 150777608) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid
PubChem CID150777608
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Name1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILESCCCCCCC1(C(=O)O)C=CC(C)=C(C(=O)O)C1
InChIInChI=1S/C15H22O4/c1-3-4-5-6-8-15(14(18)19)9-7-11(2)12(10-15)13(16)17/h7,9H,3-6,8,10H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyKBEMDJCHEYTPAD-UHFFFAOYSA-N
XLogP3.39
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 53.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The IUPAC name of 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (CID 150777608) is 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
What is the SMILES notation for 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The canonical SMILES for 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid is CCCCCCC1(C(=O)O)C=CC(C)=C(C(=O)O)C1.
What is the InChIKey of 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The InChIKey is KBEMDJCHEYTPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-3-4-5-6-8-15(14(18)19)9-7-11(2)12(10-15)13(16)17/h7,9H,3-6,8,10H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid has a molecular weight of 266.34 g/mol, XLogP of 3.39, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid is sourced from PubChem (CID 150777608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).