C25H42O4 — CID 174885576
1-nonyl-2-octylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 174885576) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-nonyl-2-octylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 1-nonyl-2-octylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174885576 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 1-nonyl-2-octylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | CCCCCCCCCC1(C(=O)O)C=CC=CC1(CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C25H42O4/c1-3-5-7-9-11-13-15-19-25(23(28)29)21-17-16-20-24(25,22(26)27)18-14-12-10-8-6-4-2/h16-17,20-21H,3-15,18-19H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | UZAGISMLIRUEHE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|