C44H78O4 — CID 67572067
1,2-bis(octadec-9-enyl)cyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 67572067) has the molecular formula C44H78O4 and a molecular weight of 671.10 g/mol. Its IUPAC name is 1,2-bis(octadec-9-enyl)cyclohex-3-ene-1,2-dicarboxylic acid.
| Compound Name | 1,2-bis(octadec-9-enyl)cyclohex-3-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67572067 |
| Molecular Formula | C44H78O4 |
| Molecular Weight | 671.10 g/mol |
| Exact Mass | 670.59 |
| IUPAC Name | 1,2-bis(octadec-9-enyl)cyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCC1(C(=O)O)C=CCCC1(CCCCCCCCC=CCCCCCCCC)C(=O)O |
| InChI | InChI=1S/C44H78O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-43(41(45)46)39-35-36-40-44(43,42(47)48)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,35,39H,3-16,21-34,36-38,40H2,1-2H3,(H,45,46)(H,47,48) |
| InChIKey | XVAQVXAVLWTYGG-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.10 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|