C14H18O6 — CID 150287390
1-prop-2-enoyloxy-2-propylcyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 150287390) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 1-prop-2-enoyloxy-2-propylcyclohex-3-ene-1,2-dicarboxylic acid.
| Compound Name | 1-prop-2-enoyloxy-2-propylcyclohex-3-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 150287390 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-prop-2-enoyloxy-2-propylcyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | C=CC(=O)OC1(C(=O)O)CCC=CC1(CCC)C(=O)O |
| InChI | InChI=1S/C14H18O6/c1-3-7-13(11(16)17)8-5-6-9-14(13,12(18)19)20-10(15)4-2/h4-5,8H,2-3,6-7,9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | GGWBRFWXDZFSTB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|