C21H28O8 — CID 70603430
1-(2-hydroxy-5-methyl-4-oxohex-5-enoxy)-2-(4-methyl-3-oxopent-4-enyl)cyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 70603430) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-(2-hydroxy-5-methyl-4-oxohex-5-enoxy)-2-(4-methyl-3-oxopent-4-enyl)cyclohex-3-ene-1,2-dicarboxylic acid.
| Compound Name | 1-(2-hydroxy-5-methyl-4-oxohex-5-enoxy)-2-(4-methyl-3-oxopent-4-enyl)cyclohex-3-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70603430 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-(2-hydroxy-5-methyl-4-oxohex-5-enoxy)-2-(4-methyl-3-oxopent-4-enyl)cyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | C=C(C)C(=O)CCC1(C(=O)O)C=CCCC1(OCC(O)CC(=O)C(=C)C)C(=O)O |
| InChI | InChI=1S/C21H28O8/c1-13(2)16(23)7-10-20(18(25)26)8-5-6-9-21(20,19(27)28)29-12-15(22)11-17(24)14(3)4/h5,8,15,22H,1,3,6-7,9-12H2,2,4H3,(H,25,26)(H,27,28) |
| InChIKey | XUBVUZLBJAVAKX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|