C19H20O3 — CID 139744476
5-hydroxy-2-methyl-6-(4-phenylphenoxy)hex-1-en-3-one (PubChem CID 139744476) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-6-(4-phenylphenoxy)hex-1-en-3-one.
| Compound Name | 5-hydroxy-2-methyl-6-(4-phenylphenoxy)hex-1-en-3-one |
|---|---|
| PubChem CID | 139744476 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 5-hydroxy-2-methyl-6-(4-phenylphenoxy)hex-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(O)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20O3/c1-14(2)19(21)12-17(20)13-22-18-10-8-16(9-11-18)15-6-4-3-5-7-15/h3-11,17,20H,1,12-13H2,2H3 |
| InChIKey | ILSICJIGQQYSGW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|