C13H20O3 — CID 159462931
6-hydroxy-2,10-dimethylundeca-1,10-diene-3,9-dione (PubChem CID 159462931) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-hydroxy-2,10-dimethylundeca-1,10-diene-3,9-dione.
| Compound Name | 6-hydroxy-2,10-dimethylundeca-1,10-diene-3,9-dione |
|---|---|
| PubChem CID | 159462931 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 6-hydroxy-2,10-dimethylundeca-1,10-diene-3,9-dione |
| SMILES | C=C(C)C(=O)CCC(O)CCC(=O)C(=C)C |
| InChI | InChI=1S/C13H20O3/c1-9(2)12(15)7-5-11(14)6-8-13(16)10(3)4/h11,14H,1,3,5-8H2,2,4H3 |
| InChIKey | SNINWVYXZUJTIR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|