C6H8F2O — CID 20610393
5,5-difluoro-2-methylpent-1-en-3-one (PubChem CID 20610393) has the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. Its IUPAC name is 5,5-difluoro-2-methylpent-1-en-3-one.
| Compound Name | 5,5-difluoro-2-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 20610393 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 5,5-difluoro-2-methylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(F)F |
| InChI | InChI=1S/C6H8F2O/c1-4(2)5(9)3-6(7)8/h6H,1,3H2,2H3 |
| InChIKey | HNZGHYLYHAOVIS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|