C8H12O — CID 20789946
2,5-dimethylhexa-1,5-dien-3-one (PubChem CID 20789946) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is 2,5-dimethylhexa-1,5-dien-3-one.
| Compound Name | 2,5-dimethylhexa-1,5-dien-3-one |
|---|---|
| PubChem CID | 20789946 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2,5-dimethylhexa-1,5-dien-3-one |
| SMILES | C=C(C)CC(=O)C(=C)C |
| InChI | InChI=1S/C8H12O/c1-6(2)5-8(9)7(3)4/h1,3,5H2,2,4H3 |
| InChIKey | OVTCGEGPTDACTQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|