About 3-methylbut-3-enamide;molecular hydrogen
3-methylbut-3-enamide;molecular hydrogen (PubChem CID 153357956) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 3-methylbut-3-enamide;molecular hydrogen.
Molecular Properties
| Compound Name | 3-methylbut-3-enamide;molecular hydrogen |
| PubChem CID | 153357956 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 3-methylbut-3-enamide;molecular hydrogen |
| SMILES | C=C(C)CC(N)=O.[H][H] |
| InChI | InChI=1S/C5H9NO.H2/c1-4(2)3-5(6)7;/h1,3H2,2H3,(H2,6,7);1H |
| InChIKey | NDWZIKATXIHOSK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-3-enamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-3-enamide;molecular hydrogen?
The IUPAC name of 3-methylbut-3-enamide;molecular hydrogen (CID 153357956) is 3-methylbut-3-enamide;molecular hydrogen.
What is the SMILES notation for 3-methylbut-3-enamide;molecular hydrogen?
The canonical SMILES for 3-methylbut-3-enamide;molecular hydrogen is C=C(C)CC(N)=O.[H][H].
What is the InChIKey of 3-methylbut-3-enamide;molecular hydrogen?
The InChIKey is NDWZIKATXIHOSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.H2/c1-4(2)3-5(6)7;/h1,3H2,2H3,(H2,6,7);1H.
What are the key properties of 3-methylbut-3-enamide;molecular hydrogen?
3-methylbut-3-enamide;molecular hydrogen has a molecular weight of 101.15 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-3-enamide;molecular hydrogen is sourced from PubChem (CID 153357956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).