C5H10N2O — CID 22226516
2-methylprop-2-enylurea (PubChem CID 22226516) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is 2-methylprop-2-enylurea.
| Compound Name | 2-methylprop-2-enylurea |
|---|---|
| PubChem CID | 22226516 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 2-methylprop-2-enylurea |
| SMILES | C=C(C)CNC(N)=O |
| InChI | InChI=1S/C5H10N2O/c1-4(2)3-7-5(6)8/h1,3H2,2H3,(H3,6,7,8) |
| InChIKey | HZZNMHAMSQOQEJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|