C10H20N2O — CID 114617228
5-amino-4-methyl-N-(2-methylprop-2-enyl)pentanamide (PubChem CID 114617228) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-amino-4-methyl-N-(2-methylprop-2-enyl)pentanamide.
| Compound Name | 5-amino-4-methyl-N-(2-methylprop-2-enyl)pentanamide |
|---|---|
| PubChem CID | 114617228 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 5-amino-4-methyl-N-(2-methylprop-2-enyl)pentanamide |
| SMILES | C=C(C)CNC(=O)CCC(C)CN |
| InChI | InChI=1S/C10H20N2O/c1-8(2)7-12-10(13)5-4-9(3)6-11/h9H,1,4-7,11H2,2-3H3,(H,12,13) |
| InChIKey | PKTJATXFYYKRHK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|