About 3-sulfonylbutanamide
3-sulfonylbutanamide (PubChem CID 87629515) has the molecular formula C4H7NO3S
and a molecular weight of 149.17 g/mol. Its IUPAC name is 3-sulfonylbutanamide.
Molecular Properties
| Compound Name | 3-sulfonylbutanamide |
| PubChem CID | 87629515 |
| Molecular Formula | C4H7NO3S |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.01 |
| IUPAC Name | 3-sulfonylbutanamide |
| SMILES | CC(CC(N)=O)=S(=O)=O |
| InChI | InChI=1S/C4H7NO3S/c1-3(9(7)8)2-4(5)6/h2H2,1H3,(H2,5,6) |
| InChIKey | BZJWEZNIZXJFHK-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfonylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfonylbutanamide?
The IUPAC name of 3-sulfonylbutanamide (CID 87629515) is 3-sulfonylbutanamide.
What is the SMILES notation for 3-sulfonylbutanamide?
The canonical SMILES for 3-sulfonylbutanamide is CC(CC(N)=O)=S(=O)=O.
What is the InChIKey of 3-sulfonylbutanamide?
The InChIKey is BZJWEZNIZXJFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3S/c1-3(9(7)8)2-4(5)6/h2H2,1H3,(H2,5,6).
What are the key properties of 3-sulfonylbutanamide?
3-sulfonylbutanamide has a molecular weight of 149.17 g/mol, XLogP of -1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfonylbutanamide is sourced from PubChem (CID 87629515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).