C8H15NO — CID 76566666
3,5-dimethylhex-3-enamide (PubChem CID 76566666) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 3,5-dimethylhex-3-enamide.
| Compound Name | 3,5-dimethylhex-3-enamide |
|---|---|
| PubChem CID | 76566666 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 3,5-dimethylhex-3-enamide |
| SMILES | CC(=CC(C)C)CC(N)=O |
| InChI | InChI=1S/C8H15NO/c1-6(2)4-7(3)5-8(9)10/h4,6H,5H2,1-3H3,(H2,9,10) |
| InChIKey | XSQHQTIYPUPLMW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|