C7H10F2O — CID 138702375
6,6-Difluoro-2-methylhex-1-en-3-one (PubChem CID 138702375) has the molecular formula C7H10F2O and a molecular weight of 148.15 g/mol. Its IUPAC name is 6,6-difluoro-2-methylhex-1-en-3-one.
| Compound Name | 6,6-Difluoro-2-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 138702375 |
| Molecular Formula | C7H10F2O |
| Molecular Weight | 148.15 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 6,6-difluoro-2-methylhex-1-en-3-one |
| SMILES | CC(=C)C(=O)CCC(F)F |
| InChI | InChI=1S/C7H10F2O/c1-5(2)6(10)3-4-7(8)9/h7H,1,3-4H2,2H3 |
| InChIKey | SPILKYKJCBIGFU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | 141 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|