C8H12F4 — CID 89314367
(E)-1,1,6,6-tetrafluoro-3,4-dimethylhex-3-ene (PubChem CID 89314367) has the molecular formula C8H12F4 and a molecular weight of 184.18 g/mol. Its IUPAC name is (E)-1,1,6,6-tetrafluoro-3,4-dimethylhex-3-ene.
| Compound Name | (E)-1,1,6,6-tetrafluoro-3,4-dimethylhex-3-ene |
|---|---|
| PubChem CID | 89314367 |
| Molecular Formula | C8H12F4 |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (E)-1,1,6,6-tetrafluoro-3,4-dimethylhex-3-ene |
| SMILES | C/C(CC(F)F)=C(/C)CC(F)F |
| InChI | InChI=1S/C8H12F4/c1-5(3-7(9)10)6(2)4-8(11)12/h7-8H,3-4H2,1-2H3/b6-5+ |
| InChIKey | IWEFVRSEESVJBZ-AATRIKPKSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|