C3H6F2N2O — CID 162600392
3,3-difluoropropanehydrazide (PubChem CID 162600392) has the molecular formula C3H6F2N2O and a molecular weight of 124.09 g/mol. Its IUPAC name is 3,3-difluoropropanehydrazide.
| Compound Name | 3,3-difluoropropanehydrazide |
|---|---|
| PubChem CID | 162600392 |
| Molecular Formula | C3H6F2N2O |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | 3,3-difluoropropanehydrazide |
| SMILES | NNC(=O)CC(F)F |
| InChI | InChI=1S/C3H6F2N2O/c4-2(5)1-3(8)7-6/h2H,1,6H2,(H,7,8) |
| InChIKey | HVWKDYOHQRAJQT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|