About 2-aminobutanedihydrazide
2-aminobutanedihydrazide (PubChem CID 13018203) has the molecular formula C4H11N5O2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-aminobutanedihydrazide.
Molecular Properties
| Compound Name | 2-aminobutanedihydrazide |
| PubChem CID | 13018203 |
| Molecular Formula | C4H11N5O2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 2-aminobutanedihydrazide |
| SMILES | NNC(=O)CC(N)C(=O)NN |
| InChI | InChI=1S/C4H11N5O2/c5-2(4(11)9-7)1-3(10)8-6/h2H,1,5-7H2,(H,8,10)(H,9,11) |
| InChIKey | UWPWADIHIRRSNS-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutanedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanedihydrazide?
The IUPAC name of 2-aminobutanedihydrazide (CID 13018203) is 2-aminobutanedihydrazide.
What is the SMILES notation for 2-aminobutanedihydrazide?
The canonical SMILES for 2-aminobutanedihydrazide is NNC(=O)CC(N)C(=O)NN.
What is the InChIKey of 2-aminobutanedihydrazide?
The InChIKey is UWPWADIHIRRSNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5O2/c5-2(4(11)9-7)1-3(10)8-6/h2H,1,5-7H2,(H,8,10)(H,9,11).
What are the key properties of 2-aminobutanedihydrazide?
2-aminobutanedihydrazide has a molecular weight of 161.16 g/mol, XLogP of -3.32, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanedihydrazide is sourced from PubChem (CID 13018203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).