C4H11Cl2N3O3 — CID 138991140
3-amino-4-hydrazinyl-4-oxobutanoic acid;dihydrochloride (PubChem CID 138991140) has the molecular formula C4H11Cl2N3O3 and a molecular weight of 220.06 g/mol. Its IUPAC name is 3-amino-4-hydrazinyl-4-oxobutanoic acid;dihydrochloride.
| Compound Name | 3-amino-4-hydrazinyl-4-oxobutanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 138991140 |
| Molecular Formula | C4H11Cl2N3O3 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 3-amino-4-hydrazinyl-4-oxobutanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NNC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C4H9N3O3.2ClH/c5-2(1-3(8)9)4(10)7-6;;/h2H,1,5-6H2,(H,7,10)(H,8,9);2*1H |
| InChIKey | KXNLADYNBFQRMO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|