C7H13N3O4 — CID 175971563
(3S)-3-amino-4-[[(2S)-2-aminopropanoyl]amino]-4-oxobutanoic acid (PubChem CID 175971563) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-2-aminopropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-2-aminopropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175971563 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-2-aminopropanoyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](N)C(=O)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C7H13N3O4/c1-3(8)6(13)10-7(14)4(9)2-5(11)12/h3-4H,2,8-9H2,1H3,(H,11,12)(H,10,13,14)/t3-,4-/m0/s1 |
| InChIKey | VDUAFEJVBJIDAD-IMJSIDKUSA-N |
| XLogP | -2.22 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |